C17H23ClN2O2 — CID 138509734
2-(chloromethyl)-N-octan-4-yl-1,3-benzoxazole-5-carboxamide (PubChem CID 138509734) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 2-(chloromethyl)-N-octan-4-yl-1,3-benzoxazole-5-carboxamide.
| Compound Name | 2-(chloromethyl)-N-octan-4-yl-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 138509734 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-(chloromethyl)-N-octan-4-yl-1,3-benzoxazole-5-carboxamide |
| SMILES | CCCCC(CCC)NC(=O)c1ccc2oc(CCl)nc2c1 |
| InChI | InChI=1S/C17H23ClN2O2/c1-3-5-7-13(6-4-2)19-17(21)12-8-9-15-14(10-12)20-16(11-18)22-15/h8-10,13H,3-7,11H2,1-2H3,(H,19,21) |
| InChIKey | VKYNNQZLRPWVGE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|