C16H22N2O3 — CID 42360414
2-butyl-N-[(2S)-2-hydroxybutyl]-1,3-benzoxazole-5-carboxamide (PubChem CID 42360414) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-butyl-N-[(2S)-2-hydroxybutyl]-1,3-benzoxazole-5-carboxamide.
| Compound Name | 2-butyl-N-[(2S)-2-hydroxybutyl]-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 42360414 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-butyl-N-[(2S)-2-hydroxybutyl]-1,3-benzoxazole-5-carboxamide |
| SMILES | CCCCc1nc2cc(C(=O)NC[C@@H](O)CC)ccc2o1 |
| InChI | InChI=1S/C16H22N2O3/c1-3-5-6-15-18-13-9-11(7-8-14(13)21-15)16(20)17-10-12(19)4-2/h7-9,12,19H,3-6,10H2,1-2H3,(H,17,20)/t12-/m0/s1 |
| InChIKey | CECTZINOGMFEFG-LBPRGKRZSA-N |
| XLogP | 2.67 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |