C20H12FNO4 — CID 136749194
2-[6-(1,3-benzodioxol-5-yl)-1,3-benzoxazol-2-yl]-6-fluorophenol (PubChem CID 136749194) has the molecular formula C20H12FNO4 and a molecular weight of 349.32 g/mol. Its IUPAC name is 2-[6-(1,3-benzodioxol-5-yl)-1,3-benzoxazol-2-yl]-6-fluorophenol.
| Compound Name | 2-[6-(1,3-benzodioxol-5-yl)-1,3-benzoxazol-2-yl]-6-fluorophenol |
|---|---|
| PubChem CID | 136749194 |
| Molecular Formula | C20H12FNO4 |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2-[6-(1,3-benzodioxol-5-yl)-1,3-benzoxazol-2-yl]-6-fluorophenol |
| SMILES | Oc1c(F)cccc1-c1nc2ccc(-c3ccc4c(c3)OCO4)cc2o1 |
| InChI | InChI=1S/C20H12FNO4/c21-14-3-1-2-13(19(14)23)20-22-15-6-4-11(8-17(15)26-20)12-5-7-16-18(9-12)25-10-24-16/h1-9,23H,10H2 |
| InChIKey | IRWDJSAHLSZIAV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |