C13H7FN2O3 — CID 44555119
2-(1,3-benzodioxol-5-yl)-5-fluoro-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 44555119) has the molecular formula C13H7FN2O3 and a molecular weight of 258.21 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-5-fluoro-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-5-fluoro-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 44555119 |
| Molecular Formula | C13H7FN2O3 |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-5-fluoro-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | Fc1ccc2nc(-c3ccc4c(c3)OCO4)oc2n1 |
| InChI | InChI=1S/C13H7FN2O3/c14-11-4-2-8-13(16-11)19-12(15-8)7-1-3-9-10(5-7)18-6-17-9/h1-5H,6H2 |
| InChIKey | NEUWLAUEEFUZRF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|