C16H12FN3O — CID 58220164
2-(2,3-dimethyl-1H-indol-5-yl)-5-fluoro-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 58220164) has the molecular formula C16H12FN3O and a molecular weight of 281.29 g/mol. Its IUPAC name is 2-(2,3-dimethyl-1H-indol-5-yl)-5-fluoro-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 2-(2,3-dimethyl-1H-indol-5-yl)-5-fluoro-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 58220164 |
| Molecular Formula | C16H12FN3O |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-(2,3-dimethyl-1H-indol-5-yl)-5-fluoro-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | Cc1[nH]c2ccc(-c3nc4ccc(F)nc4o3)cc2c1C |
| InChI | InChI=1S/C16H12FN3O/c1-8-9(2)18-12-4-3-10(7-11(8)12)15-19-13-5-6-14(17)20-16(13)21-15/h3-7,18H,1-2H3 |
| InChIKey | LEHCCJXKJCPAFL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|