C21H29N5O — CID 42609848
5-(2,3-dimethyl-1H-indol-5-yl)-N-(4-piperidin-1-ylbutyl)-1,3,4-oxadiazol-2-amine (PubChem CID 42609848) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is 5-(2,3-dimethyl-1H-indol-5-yl)-N-(4-piperidin-1-ylbutyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2,3-dimethyl-1H-indol-5-yl)-N-(4-piperidin-1-ylbutyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 42609848 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 5-(2,3-dimethyl-1H-indol-5-yl)-N-(4-piperidin-1-ylbutyl)-1,3,4-oxadiazol-2-amine |
| SMILES | Cc1[nH]c2ccc(-c3nnc(NCCCCN4CCCCC4)o3)cc2c1C |
| InChI | InChI=1S/C21H29N5O/c1-15-16(2)23-19-9-8-17(14-18(15)19)20-24-25-21(27-20)22-10-4-7-13-26-11-5-3-6-12-26/h8-9,14,23H,3-7,10-13H2,1-2H3,(H,22,25) |
| InChIKey | IJDRWACWBMEHCH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 69.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|