C18H23N5O — CID 135879429
5-(1H-indol-2-yl)-N-(3-piperidin-1-ylpropyl)-1,3,4-oxadiazol-2-amine (PubChem CID 135879429) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is 5-(1H-indol-2-yl)-N-(3-piperidin-1-ylpropyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(1H-indol-2-yl)-N-(3-piperidin-1-ylpropyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 135879429 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 5-(1H-indol-2-yl)-N-(3-piperidin-1-ylpropyl)-1,3,4-oxadiazol-2-amine |
| SMILES | c1ccc2[nH]c(-c3nnc(NCCCN4CCCCC4)o3)cc2c1 |
| InChI | InChI=1S/C18H23N5O/c1-4-10-23(11-5-1)12-6-9-19-18-22-21-17(24-18)16-13-14-7-2-3-8-15(14)20-16/h2-3,7-8,13,20H,1,4-6,9-12H2,(H,19,22) |
| InChIKey | LTHZPSMOSSCFDI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 69.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|