C26H25NO6 — CID 46089045
[2,6-dimethoxy-4-[6-(4-methoxy-3,5-dimethylphenyl)-1,3-benzoxazol-2-yl]phenyl] acetate (PubChem CID 46089045) has the molecular formula C26H25NO6 and a molecular weight of 447.49 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[6-(4-methoxy-3,5-dimethylphenyl)-1,3-benzoxazol-2-yl]phenyl] acetate.
| Compound Name | [2,6-dimethoxy-4-[6-(4-methoxy-3,5-dimethylphenyl)-1,3-benzoxazol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 46089045 |
| Molecular Formula | C26H25NO6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | [2,6-dimethoxy-4-[6-(4-methoxy-3,5-dimethylphenyl)-1,3-benzoxazol-2-yl]phenyl] acetate |
| SMILES | COc1cc(-c2nc3ccc(-c4cc(C)c(OC)c(C)c4)cc3o2)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C26H25NO6/c1-14-9-18(10-15(2)24(14)31-6)17-7-8-20-21(11-17)33-26(27-20)19-12-22(29-4)25(32-16(3)28)23(13-19)30-5/h7-13H,1-6H3 |
| InChIKey | DLOXPCIBUBNUDD-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 80.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|