C17H13NO3S — CID 118509668
[2-methyl-4-(4-sulfanylidene-3,1-benzoxazin-2-yl)phenyl] acetate (PubChem CID 118509668) has the molecular formula C17H13NO3S and a molecular weight of 311.36 g/mol. Its IUPAC name is [2-methyl-4-(4-sulfanylidene-3,1-benzoxazin-2-yl)phenyl] acetate.
| Compound Name | [2-methyl-4-(4-sulfanylidene-3,1-benzoxazin-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 118509668 |
| Molecular Formula | C17H13NO3S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | [2-methyl-4-(4-sulfanylidene-3,1-benzoxazin-2-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2nc3ccccc3c(=S)o2)cc1C |
| InChI | InChI=1S/C17H13NO3S/c1-10-9-12(7-8-15(10)20-11(2)19)16-18-14-6-4-3-5-13(14)17(22)21-16/h3-9H,1-2H3 |
| InChIKey | PKHLPIRBQJLVQG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|