C38H24N2O10 — CID 3098427
bis[2-methoxy-4-(4-oxo-3,1-benzoxazin-2-yl)phenyl] benzene-1,4-dicarboxylate (PubChem CID 3098427) has the molecular formula C38H24N2O10 and a molecular weight of 668.61 g/mol. Its IUPAC name is bis[2-methoxy-4-(4-oxo-3,1-benzoxazin-2-yl)phenyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[2-methoxy-4-(4-oxo-3,1-benzoxazin-2-yl)phenyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 3098427 |
| Molecular Formula | C38H24N2O10 |
| Molecular Weight | 668.61 g/mol |
| Exact Mass | 668.14 |
| IUPAC Name | bis[2-methoxy-4-(4-oxo-3,1-benzoxazin-2-yl)phenyl] benzene-1,4-dicarboxylate |
| SMILES | COc1cc(-c2nc3ccccc3c(=O)o2)ccc1OC(=O)c1ccc(C(=O)Oc2ccc(-c3nc4ccccc4c(=O)o3)cc2OC)cc1 |
| InChI | InChI=1S/C38H24N2O10/c1-45-31-19-23(33-39-27-9-5-3-7-25(27)37(43)49-33)15-17-29(31)47-35(41)21-11-13-22(14-12-21)36(42)48-30-18-16-24(20-32(30)46-2)34-40-28-10-6-4-8-26(28)38(44)50-34/h3-20H,1-2H3 |
| InChIKey | HWUXAWWTCVFQOR-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 157.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.61 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|