C35H21NO8 — CID 118509597
[2,3-dibenzoyloxy-5-(4-oxo-3,1-benzoxazin-2-yl)phenyl] benzoate (PubChem CID 118509597) has the molecular formula C35H21NO8 and a molecular weight of 583.55 g/mol. Its IUPAC name is [2,3-dibenzoyloxy-5-(4-oxo-3,1-benzoxazin-2-yl)phenyl] benzoate.
| Compound Name | [2,3-dibenzoyloxy-5-(4-oxo-3,1-benzoxazin-2-yl)phenyl] benzoate |
|---|---|
| PubChem CID | 118509597 |
| Molecular Formula | C35H21NO8 |
| Molecular Weight | 583.55 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | [2,3-dibenzoyloxy-5-(4-oxo-3,1-benzoxazin-2-yl)phenyl] benzoate |
| SMILES | O=C(Oc1cc(-c2nc3ccccc3c(=O)o2)cc(OC(=O)c2ccccc2)c1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H21NO8/c37-32(22-12-4-1-5-13-22)41-28-20-25(31-36-27-19-11-10-18-26(27)35(40)44-31)21-29(42-33(38)23-14-6-2-7-15-23)30(28)43-34(39)24-16-8-3-9-17-24/h1-21H |
| InChIKey | QGZSXCMZVASXLM-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 122.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.55 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|