C17H13NO2S2 — CID 118509683
[2-methyl-4-(4-sulfanylidene-1,3-benzothiazin-2-yl)phenyl] acetate (PubChem CID 118509683) has the molecular formula C17H13NO2S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is [2-methyl-4-(4-sulfanylidene-1,3-benzothiazin-2-yl)phenyl] acetate.
| Compound Name | [2-methyl-4-(4-sulfanylidene-1,3-benzothiazin-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 118509683 |
| Molecular Formula | C17H13NO2S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | [2-methyl-4-(4-sulfanylidene-1,3-benzothiazin-2-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2nc(=S)c3ccccc3s2)cc1C |
| InChI | InChI=1S/C17H13NO2S2/c1-10-9-12(7-8-14(10)20-11(2)19)17-18-16(21)13-5-3-4-6-15(13)22-17/h3-9H,1-2H3 |
| InChIKey | PHIBETMGIGYEKN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|