C18H16N2O3S — CID 10688514
[2-(4-acetamido-3-methylphenyl)-1,3-benzothiazol-4-yl] acetate (PubChem CID 10688514) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is [2-(4-acetamido-3-methylphenyl)-1,3-benzothiazol-4-yl] acetate.
| Compound Name | [2-(4-acetamido-3-methylphenyl)-1,3-benzothiazol-4-yl] acetate |
|---|---|
| PubChem CID | 10688514 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | [2-(4-acetamido-3-methylphenyl)-1,3-benzothiazol-4-yl] acetate |
| SMILES | CC(=O)Nc1ccc(-c2nc3c(OC(C)=O)cccc3s2)cc1C |
| InChI | InChI=1S/C18H16N2O3S/c1-10-9-13(7-8-14(10)19-11(2)21)18-20-17-15(23-12(3)22)5-4-6-16(17)24-18/h4-9H,1-3H3,(H,19,21) |
| InChIKey | VLFMITOMWKNUBY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|