C15H10BrNO2S — CID 10497893
[2-(4-bromophenyl)-1,3-benzothiazol-4-yl] acetate (PubChem CID 10497893) has the molecular formula C15H10BrNO2S and a molecular weight of 348.22 g/mol. Its IUPAC name is [2-(4-bromophenyl)-1,3-benzothiazol-4-yl] acetate.
| Compound Name | [2-(4-bromophenyl)-1,3-benzothiazol-4-yl] acetate |
|---|---|
| PubChem CID | 10497893 |
| Molecular Formula | C15H10BrNO2S |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 346.96 |
| IUPAC Name | [2-(4-bromophenyl)-1,3-benzothiazol-4-yl] acetate |
| SMILES | CC(=O)Oc1cccc2sc(-c3ccc(Br)cc3)nc12 |
| InChI | InChI=1S/C15H10BrNO2S/c1-9(18)19-12-3-2-4-13-14(12)17-15(20-13)10-5-7-11(16)8-6-10/h2-8H,1H3 |
| InChIKey | VWNJSGSUDJVJKF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|