C18H16O4S — CID 58849633
(8-acetyloxy-3,7-dimethyldibenzothiophen-2-yl) acetate (PubChem CID 58849633) has the molecular formula C18H16O4S and a molecular weight of 328.39 g/mol. Its IUPAC name is (8-acetyloxy-3,7-dimethyldibenzothiophen-2-yl) acetate.
| Compound Name | (8-acetyloxy-3,7-dimethyldibenzothiophen-2-yl) acetate |
|---|---|
| PubChem CID | 58849633 |
| Molecular Formula | C18H16O4S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | (8-acetyloxy-3,7-dimethyldibenzothiophen-2-yl) acetate |
| SMILES | CC(=O)Oc1cc2c(cc1C)sc1cc(C)c(OC(C)=O)cc12 |
| InChI | InChI=1S/C18H16O4S/c1-9-5-17-13(7-15(9)21-11(3)19)14-8-16(22-12(4)20)10(2)6-18(14)23-17/h5-8H,1-4H3 |
| InChIKey | MNANIONGJBAZOO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|