C16H13NO4 — CID 149261528
2-hydroxy-1-[2-(4-methoxyphenyl)-1,3-benzoxazol-6-yl]ethanone (PubChem CID 149261528) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-hydroxy-1-[2-(4-methoxyphenyl)-1,3-benzoxazol-6-yl]ethanone.
| Compound Name | 2-hydroxy-1-[2-(4-methoxyphenyl)-1,3-benzoxazol-6-yl]ethanone |
|---|---|
| PubChem CID | 149261528 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-hydroxy-1-[2-(4-methoxyphenyl)-1,3-benzoxazol-6-yl]ethanone |
| SMILES | COc1ccc(-c2nc3ccc(C(=O)CO)cc3o2)cc1 |
| InChI | InChI=1S/C16H13NO4/c1-20-12-5-2-10(3-6-12)16-17-13-7-4-11(14(19)9-18)8-15(13)21-16/h2-8,18H,9H2,1H3 |
| InChIKey | XPICJYOCNVLXHJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |