C22H18N2O4 — CID 142897934
3-[5-(1,3-benzodioxol-5-yl)-1,3-benzoxazol-2-yl]-4-methoxy-N-methylaniline (PubChem CID 142897934) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is 3-[5-(1,3-benzodioxol-5-yl)-1,3-benzoxazol-2-yl]-4-methoxy-N-methylaniline.
| Compound Name | 3-[5-(1,3-benzodioxol-5-yl)-1,3-benzoxazol-2-yl]-4-methoxy-N-methylaniline |
|---|---|
| PubChem CID | 142897934 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 3-[5-(1,3-benzodioxol-5-yl)-1,3-benzoxazol-2-yl]-4-methoxy-N-methylaniline |
| SMILES | CNc1ccc(OC)c(-c2nc3cc(-c4ccc5c(c4)OCO5)ccc3o2)c1 |
| InChI | InChI=1S/C22H18N2O4/c1-23-15-5-8-18(25-2)16(11-15)22-24-17-9-13(3-6-19(17)28-22)14-4-7-20-21(10-14)27-12-26-20/h3-11,23H,12H2,1-2H3 |
| InChIKey | RXCZQFLXMSMLCR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 65.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|