C25H21NO7 — CID 139511855
4-[[9-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-1-oxo-3H-benzo[f][2]benzofuran-4-yl]oxy]butanenitrile (PubChem CID 139511855) has the molecular formula C25H21NO7 and a molecular weight of 447.44 g/mol. Its IUPAC name is 4-[[9-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-1-oxo-3H-benzo[f][2]benzofuran-4-yl]oxy]butanenitrile.
| Compound Name | 4-[[9-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-1-oxo-3H-benzo[f][2]benzofuran-4-yl]oxy]butanenitrile |
|---|---|
| PubChem CID | 139511855 |
| Molecular Formula | C25H21NO7 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 4-[[9-(1,3-benzodioxol-5-yl)-6,7-dimethoxy-1-oxo-3H-benzo[f][2]benzofuran-4-yl]oxy]butanenitrile |
| SMILES | COc1cc2c(OCCCC#N)c3c(c(-c4ccc5c(c4)OCO5)c2cc1OC)C(=O)OC3 |
| InChI | InChI=1S/C25H21NO7/c1-28-19-10-15-16(11-20(19)29-2)24(30-8-4-3-7-26)17-12-31-25(27)23(17)22(15)14-5-6-18-21(9-14)33-13-32-18/h5-6,9-11H,3-4,8,12-13H2,1-2H3 |
| InChIKey | PJZTVWQUSIUJPD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 96.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|