C38H36O8Si — CID 169446908
5-[tert-butyl(diphenyl)silyl]oxy-9-(3,4,5-trimethoxyphenyl)-6H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one (PubChem CID 169446908) has the molecular formula C38H36O8Si and a molecular weight of 648.78 g/mol. Its IUPAC name is 5-[tert-butyl(diphenyl)silyl]oxy-9-(3,4,5-trimethoxyphenyl)-6H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one.
| Compound Name | 5-[tert-butyl(diphenyl)silyl]oxy-9-(3,4,5-trimethoxyphenyl)-6H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
|---|---|
| PubChem CID | 169446908 |
| Molecular Formula | C38H36O8Si |
| Molecular Weight | 648.78 g/mol |
| Exact Mass | 648.22 |
| IUPAC Name | 5-[tert-butyl(diphenyl)silyl]oxy-9-(3,4,5-trimethoxyphenyl)-6H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
| SMILES | COc1cc(-c2c3c(c(O[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)c4cc5c(cc24)OCO5)COC3=O)cc(OC)c1OC |
| InChI | InChI=1S/C38H36O8Si/c1-38(2,3)47(24-13-9-7-10-14-24,25-15-11-8-12-16-25)46-35-27-20-30-29(44-22-45-30)19-26(27)33(34-28(35)21-43-37(34)39)23-17-31(40-4)36(42-6)32(18-23)41-5/h7-20H,21-22H2,1-6H3 |
| InChIKey | IILUJJXGJVBEGD-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.78 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|