C24H22O8 — CID 129085928
9-(1,3-benzodioxol-5-yl)-6,7-bis(hydroxymethyl)-4-(3-hydroxypropoxy)-3H-benzo[f][2]benzofuran-1-one (PubChem CID 129085928) has the molecular formula C24H22O8 and a molecular weight of 438.43 g/mol. Its IUPAC name is 9-(1,3-benzodioxol-5-yl)-6,7-bis(hydroxymethyl)-4-(3-hydroxypropoxy)-3H-benzo[f][2]benzofuran-1-one.
| Compound Name | 9-(1,3-benzodioxol-5-yl)-6,7-bis(hydroxymethyl)-4-(3-hydroxypropoxy)-3H-benzo[f][2]benzofuran-1-one |
|---|---|
| PubChem CID | 129085928 |
| Molecular Formula | C24H22O8 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 9-(1,3-benzodioxol-5-yl)-6,7-bis(hydroxymethyl)-4-(3-hydroxypropoxy)-3H-benzo[f][2]benzofuran-1-one |
| SMILES | O=C1OCc2c1c(-c1ccc3c(c1)OCO3)c1cc(CO)c(CO)cc1c2OCCCO |
| InChI | InChI=1S/C24H22O8/c25-4-1-5-29-23-17-7-15(10-27)14(9-26)6-16(17)21(22-18(23)11-30-24(22)28)13-2-3-19-20(8-13)32-12-31-19/h2-3,6-8,25-27H,1,4-5,9-12H2 |
| InChIKey | KYOMDGQBPUDWJD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|