C27H27BO8 — CID 156626860
4-(1,3-benzodioxol-5-yl)-6,7-bis(hydroxymethyl)-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[f][2]benzofuran-3-one (PubChem CID 156626860) has the molecular formula C27H27BO8 and a molecular weight of 490.32 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-6,7-bis(hydroxymethyl)-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[f][2]benzofuran-3-one.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-6,7-bis(hydroxymethyl)-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[f][2]benzofuran-3-one |
|---|---|
| PubChem CID | 156626860 |
| Molecular Formula | C27H27BO8 |
| Molecular Weight | 490.32 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-6,7-bis(hydroxymethyl)-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[f][2]benzofuran-3-one |
| SMILES | CC1(C)OB(c2c3c(c(-c4ccc5c(c4)OCO5)c4cc(CO)c(CO)cc24)C(=O)OC3)OC1(C)C |
| InChI | InChI=1S/C27H27BO8/c1-26(2)27(3,4)36-28(35-26)24-18-8-16(11-30)15(10-29)7-17(18)22(23-19(24)12-32-25(23)31)14-5-6-20-21(9-14)34-13-33-20/h5-9,29-30H,10-13H2,1-4H3 |
| InChIKey | PTFDAKWKPNKMTF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|