C26H24O11 — CID 156626931
9-(1,3-benzodioxol-5-yl)-6,7-bis(hydroxymethyl)-4-[(3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-3H-benzo[f][2]benzofuran-1-one (PubChem CID 156626931) has the molecular formula C26H24O11 and a molecular weight of 512.47 g/mol. Its IUPAC name is 9-(1,3-benzodioxol-5-yl)-6,7-bis(hydroxymethyl)-4-[(3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-3H-benzo[f][2]benzofuran-1-one.
| Compound Name | 9-(1,3-benzodioxol-5-yl)-6,7-bis(hydroxymethyl)-4-[(3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-3H-benzo[f][2]benzofuran-1-one |
|---|---|
| PubChem CID | 156626931 |
| Molecular Formula | C26H24O11 |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 9-(1,3-benzodioxol-5-yl)-6,7-bis(hydroxymethyl)-4-[(3R,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxy-3H-benzo[f][2]benzofuran-1-one |
| SMILES | O=C1OCc2c1c(-c1ccc3c(c1)OCO3)c1cc(CO)c(CO)cc1c2OC1OC[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H24O11/c27-6-12-3-14-15(4-13(12)7-28)24(37-26-23(31)22(30)17(29)9-34-26)16-8-33-25(32)21(16)20(14)11-1-2-18-19(5-11)36-10-35-18/h1-5,17,22-23,26-31H,6-10H2/t17-,22-,23+,26?/m0/s1 |
| InChIKey | FRPKXINFRCVOBZ-BDIREPLNSA-N |
| XLogP | 0.71 |
| TPSA | 164.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |