C21H20F3NO7S — CID 87076985
[5-(6,7-dimethoxy-1-methylisoquinolin-3-yl)-2,3-dimethoxyphenyl] trifluoromethanesulfonate (PubChem CID 87076985) has the molecular formula C21H20F3NO7S and a molecular weight of 487.45 g/mol. Its IUPAC name is [5-(6,7-dimethoxy-1-methylisoquinolin-3-yl)-2,3-dimethoxyphenyl] trifluoromethanesulfonate.
| Compound Name | [5-(6,7-dimethoxy-1-methylisoquinolin-3-yl)-2,3-dimethoxyphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87076985 |
| Molecular Formula | C21H20F3NO7S |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | [5-(6,7-dimethoxy-1-methylisoquinolin-3-yl)-2,3-dimethoxyphenyl] trifluoromethanesulfonate |
| SMILES | COc1cc2cc(-c3cc(OC)c(OC)c(OS(=O)(=O)C(F)(F)F)c3)nc(C)c2cc1OC |
| InChI | InChI=1S/C21H20F3NO7S/c1-11-14-10-17(29-3)16(28-2)7-12(14)6-15(25-11)13-8-18(30-4)20(31-5)19(9-13)32-33(26,27)21(22,23)24/h6-10H,1-5H3 |
| InChIKey | BBYIGUJZEWPKCO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|