C20H19NO5 — CID 11958359
2-[3-(1,3-benzodioxol-5-yl)-6,7-dimethoxyisoquinolin-4-yl]ethanol (PubChem CID 11958359) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is 2-[3-(1,3-benzodioxol-5-yl)-6,7-dimethoxyisoquinolin-4-yl]ethanol.
| Compound Name | 2-[3-(1,3-benzodioxol-5-yl)-6,7-dimethoxyisoquinolin-4-yl]ethanol |
|---|---|
| PubChem CID | 11958359 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-[3-(1,3-benzodioxol-5-yl)-6,7-dimethoxyisoquinolin-4-yl]ethanol |
| SMILES | COc1cc2cnc(-c3ccc4c(c3)OCO4)c(CCO)c2cc1OC |
| InChI | InChI=1S/C20H19NO5/c1-23-17-8-13-10-21-20(12-3-4-16-19(7-12)26-11-25-16)14(5-6-22)15(13)9-18(17)24-2/h3-4,7-10,22H,5-6,11H2,1-2H3 |
| InChIKey | ALYBNAFSTOOIRQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |