C18H16N4O3 — CID 11724549
4-(3-amino-4-methoxyphenyl)-N-(1,3-benzodioxol-5-yl)pyrimidin-2-amine (PubChem CID 11724549) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 4-(3-amino-4-methoxyphenyl)-N-(1,3-benzodioxol-5-yl)pyrimidin-2-amine.
| Compound Name | 4-(3-amino-4-methoxyphenyl)-N-(1,3-benzodioxol-5-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 11724549 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 4-(3-amino-4-methoxyphenyl)-N-(1,3-benzodioxol-5-yl)pyrimidin-2-amine |
| SMILES | COc1ccc(-c2ccnc(Nc3ccc4c(c3)OCO4)n2)cc1N |
| InChI | InChI=1S/C18H16N4O3/c1-23-15-4-2-11(8-13(15)19)14-6-7-20-18(22-14)21-12-3-5-16-17(9-12)25-10-24-16/h2-9H,10,19H2,1H3,(H,20,21,22) |
| InChIKey | ZSOFXZIBZPIXQJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|