C19H22F2N2OS — CID 2741951
1-(2,4-difluorophenyl)-3-[2-[(2,4,6-trimethylphenyl)methylsulfanyl]ethyl]urea (PubChem CID 2741951) has the molecular formula C19H22F2N2OS and a molecular weight of 364.46 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[2-[(2,4,6-trimethylphenyl)methylsulfanyl]ethyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[2-[(2,4,6-trimethylphenyl)methylsulfanyl]ethyl]urea |
|---|---|
| PubChem CID | 2741951 |
| Molecular Formula | C19H22F2N2OS |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[2-[(2,4,6-trimethylphenyl)methylsulfanyl]ethyl]urea |
| SMILES | Cc1cc(C)c(CSCCNC(=O)Nc2ccc(F)cc2F)c(C)c1 |
| InChI | InChI=1S/C19H22F2N2OS/c1-12-8-13(2)16(14(3)9-12)11-25-7-6-22-19(24)23-18-5-4-15(20)10-17(18)21/h4-5,8-10H,6-7,11H2,1-3H3,(H2,22,23,24) |
| InChIKey | MAIFCMMKZIMUJN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|