C9H9F2N5O — CID 61343254
1-(2-azidoethyl)-3-(2,4-difluorophenyl)urea (PubChem CID 61343254) has the molecular formula C9H9F2N5O and a molecular weight of 241.20 g/mol. Its IUPAC name is 1-(2-azidoethyl)-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-(2-azidoethyl)-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 61343254 |
| Molecular Formula | C9H9F2N5O |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 1-(2-azidoethyl)-3-(2,4-difluorophenyl)urea |
| SMILES | [N-]=[N+]=NCCNC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C9H9F2N5O/c10-6-1-2-8(7(11)5-6)15-9(17)13-3-4-14-16-12/h1-2,5H,3-4H2,(H2,13,15,17) |
| InChIKey | JBEBNHGBRHEWAA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|