C21H25FN4O3 — CID 121063359
4-(2,2-dimethylpropanoylamino)-N-[2-[(3-fluorophenyl)carbamoylamino]ethyl]benzamide (PubChem CID 121063359) has the molecular formula C21H25FN4O3 and a molecular weight of 400.45 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoylamino)-N-[2-[(3-fluorophenyl)carbamoylamino]ethyl]benzamide.
| Compound Name | 4-(2,2-dimethylpropanoylamino)-N-[2-[(3-fluorophenyl)carbamoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 121063359 |
| Molecular Formula | C21H25FN4O3 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 4-(2,2-dimethylpropanoylamino)-N-[2-[(3-fluorophenyl)carbamoylamino]ethyl]benzamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(C(=O)NCCNC(=O)Nc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C21H25FN4O3/c1-21(2,3)19(28)25-16-9-7-14(8-10-16)18(27)23-11-12-24-20(29)26-17-6-4-5-15(22)13-17/h4-10,13H,11-12H2,1-3H3,(H,23,27)(H,25,28)(H2,24,26,29) |
| InChIKey | KMGBCHYOTCAJDB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|