C22H25F3N4O3 — CID 121063372
4-(2,2-dimethylpropanoylamino)-N-[2-[[2-(trifluoromethyl)phenyl]carbamoylamino]ethyl]benzamide (PubChem CID 121063372) has the molecular formula C22H25F3N4O3 and a molecular weight of 450.46 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoylamino)-N-[2-[[2-(trifluoromethyl)phenyl]carbamoylamino]ethyl]benzamide.
| Compound Name | 4-(2,2-dimethylpropanoylamino)-N-[2-[[2-(trifluoromethyl)phenyl]carbamoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 121063372 |
| Molecular Formula | C22H25F3N4O3 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 4-(2,2-dimethylpropanoylamino)-N-[2-[[2-(trifluoromethyl)phenyl]carbamoylamino]ethyl]benzamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(C(=O)NCCNC(=O)Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H25F3N4O3/c1-21(2,3)19(31)28-15-10-8-14(9-11-15)18(30)26-12-13-27-20(32)29-17-7-5-4-6-16(17)22(23,24)25/h4-11H,12-13H2,1-3H3,(H,26,30)(H,28,31)(H2,27,29,32) |
| InChIKey | ABIQAJNLECSPLJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|