C13H18F3N3O2 — CID 83036718
1-[2-(2-methoxyethylamino)ethyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 83036718) has the molecular formula C13H18F3N3O2 and a molecular weight of 305.30 g/mol. Its IUPAC name is 1-[2-(2-methoxyethylamino)ethyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-(2-methoxyethylamino)ethyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 83036718 |
| Molecular Formula | C13H18F3N3O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-[2-(2-methoxyethylamino)ethyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | COCCNCCNC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H18F3N3O2/c1-21-9-8-17-6-7-18-12(20)19-11-5-3-2-4-10(11)13(14,15)16/h2-5,17H,6-9H2,1H3,(H2,18,19,20) |
| InChIKey | CEYYDKLJFUWACY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|