C12H15F3N2O3 — CID 47223994
1-(2-methoxyethyl)-3-[4-methoxy-2-(trifluoromethyl)phenyl]urea (PubChem CID 47223994) has the molecular formula C12H15F3N2O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[4-methoxy-2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(2-methoxyethyl)-3-[4-methoxy-2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 47223994 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[4-methoxy-2-(trifluoromethyl)phenyl]urea |
| SMILES | COCCNC(=O)Nc1ccc(OC)cc1C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O3/c1-19-6-5-16-11(18)17-10-4-3-8(20-2)7-9(10)12(13,14)15/h3-4,7H,5-6H2,1-2H3,(H2,16,17,18) |
| InChIKey | ZIDAXXWMZHGAHE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|