C19H19F3N4O3 — CID 121062071
N-(2-acetamidoethyl)-4-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide (PubChem CID 121062071) has the molecular formula C19H19F3N4O3 and a molecular weight of 408.38 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-4-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide.
| Compound Name | N-(2-acetamidoethyl)-4-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 121062071 |
| Molecular Formula | C19H19F3N4O3 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-(2-acetamidoethyl)-4-[[2-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
| SMILES | CC(=O)NCCNC(=O)c1ccc(NC(=O)Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H19F3N4O3/c1-12(27)23-10-11-24-17(28)13-6-8-14(9-7-13)25-18(29)26-16-5-3-2-4-15(16)19(20,21)22/h2-9H,10-11H2,1H3,(H,23,27)(H,24,28)(H2,25,26,29) |
| InChIKey | CNIKFZBKAAQTTD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|