C20H24N4O3 — CID 121062212
N-(2-acetamidoethyl)-4-[(3,5-dimethylphenyl)carbamoylamino]benzamide (PubChem CID 121062212) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-4-[(3,5-dimethylphenyl)carbamoylamino]benzamide.
| Compound Name | N-(2-acetamidoethyl)-4-[(3,5-dimethylphenyl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 121062212 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-(2-acetamidoethyl)-4-[(3,5-dimethylphenyl)carbamoylamino]benzamide |
| SMILES | CC(=O)NCCNC(=O)c1ccc(NC(=O)Nc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C20H24N4O3/c1-13-10-14(2)12-18(11-13)24-20(27)23-17-6-4-16(5-7-17)19(26)22-9-8-21-15(3)25/h4-7,10-12H,8-9H2,1-3H3,(H,21,25)(H,22,26)(H2,23,24,27) |
| InChIKey | XLXBGLMYELLDGS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|