C12H13FN4S — CID 4874785
1-(4-fluorophenyl)-3-[2-(1H-imidazol-5-yl)ethyl]thiourea (PubChem CID 4874785) has the molecular formula C12H13FN4S and a molecular weight of 264.33 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[2-(1H-imidazol-5-yl)ethyl]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[2-(1H-imidazol-5-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 4874785 |
| Molecular Formula | C12H13FN4S |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[2-(1H-imidazol-5-yl)ethyl]thiourea |
| SMILES | Fc1ccc(NC(=S)NCCc2cnc[nH]2)cc1 |
| InChI | InChI=1S/C12H13FN4S/c13-9-1-3-10(4-2-9)17-12(18)15-6-5-11-7-14-8-16-11/h1-4,7-8H,5-6H2,(H,14,16)(H2,15,17,18) |
| InChIKey | KYGHVVFDZGHDLF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|