C19H22N4O2 — CID 75522555
1-(1-ethyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(2-pyridin-2-ylethyl)urea (PubChem CID 75522555) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-(1-ethyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(2-pyridin-2-ylethyl)urea.
| Compound Name | 1-(1-ethyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(2-pyridin-2-ylethyl)urea |
|---|---|
| PubChem CID | 75522555 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-(1-ethyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(2-pyridin-2-ylethyl)urea |
| SMILES | CCN1C(=O)CCc2cc(NC(=O)NCCc3ccccn3)ccc21 |
| InChI | InChI=1S/C19H22N4O2/c1-2-23-17-8-7-16(13-14(17)6-9-18(23)24)22-19(25)21-12-10-15-5-3-4-11-20-15/h3-5,7-8,11,13H,2,6,9-10,12H2,1H3,(H2,21,22,25) |
| InChIKey | OIYWOZWCKYILDF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |