C18H18N2O3 — CID 27639376
phenyl N-(1-ethyl-2-oxo-3,4-dihydroquinolin-6-yl)carbamate (PubChem CID 27639376) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is phenyl N-(1-ethyl-2-oxo-3,4-dihydroquinolin-6-yl)carbamate.
| Compound Name | phenyl N-(1-ethyl-2-oxo-3,4-dihydroquinolin-6-yl)carbamate |
|---|---|
| PubChem CID | 27639376 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | phenyl N-(1-ethyl-2-oxo-3,4-dihydroquinolin-6-yl)carbamate |
| SMILES | CCN1C(=O)CCc2cc(NC(=O)Oc3ccccc3)ccc21 |
| InChI | InChI=1S/C18H18N2O3/c1-2-20-16-10-9-14(12-13(16)8-11-17(20)21)19-18(22)23-15-6-4-3-5-7-15/h3-7,9-10,12H,2,8,11H2,1H3,(H,19,22) |
| InChIKey | RVRVZCPZRKQQKP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |