C19H21N3O2 — CID 30376245
1-(1-ethyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(3-methylphenyl)urea (PubChem CID 30376245) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-(1-ethyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(3-methylphenyl)urea.
| Compound Name | 1-(1-ethyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 30376245 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 1-(1-ethyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(3-methylphenyl)urea |
| SMILES | CCN1C(=O)CCc2cc(NC(=O)Nc3cccc(C)c3)ccc21 |
| InChI | InChI=1S/C19H21N3O2/c1-3-22-17-9-8-16(12-14(17)7-10-18(22)23)21-19(24)20-15-6-4-5-13(2)11-15/h4-6,8-9,11-12H,3,7,10H2,1-2H3,(H2,20,21,24) |
| InChIKey | OSIFUIVFTWIJDZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |