C17H18N2O2S — CID 71842958
N-(2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)thiophene-3-carboxamide (PubChem CID 71842958) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is N-(2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)thiophene-3-carboxamide.
| Compound Name | N-(2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 71842958 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-(2-oxo-1-propyl-3,4-dihydroquinolin-6-yl)thiophene-3-carboxamide |
| SMILES | CCCN1C(=O)CCc2cc(NC(=O)c3ccsc3)ccc21 |
| InChI | InChI=1S/C17H18N2O2S/c1-2-8-19-15-5-4-14(10-12(15)3-6-16(19)20)18-17(21)13-7-9-22-11-13/h4-5,7,9-11H,2-3,6,8H2,1H3,(H,18,21) |
| InChIKey | BTNQYJJZHKOQEX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |