C18H26N2O2 — CID 16926947
N-(1-butyl-2-oxo-3,4-dihydroquinolin-6-yl)pentanamide (PubChem CID 16926947) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N-(1-butyl-2-oxo-3,4-dihydroquinolin-6-yl)pentanamide.
| Compound Name | N-(1-butyl-2-oxo-3,4-dihydroquinolin-6-yl)pentanamide |
|---|---|
| PubChem CID | 16926947 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | N-(1-butyl-2-oxo-3,4-dihydroquinolin-6-yl)pentanamide |
| SMILES | CCCCC(=O)Nc1ccc2c(c1)CCC(=O)N2CCCC |
| InChI | InChI=1S/C18H26N2O2/c1-3-5-7-17(21)19-15-9-10-16-14(13-15)8-11-18(22)20(16)12-6-4-2/h9-10,13H,3-8,11-12H2,1-2H3,(H,19,21) |
| InChIKey | KMMPUXUKLFDGBY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |