C22H27N3O4 — CID 30376842
1-(1-butyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(2,4-dimethoxyphenyl)urea (PubChem CID 30376842) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 1-(1-butyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(2,4-dimethoxyphenyl)urea.
| Compound Name | 1-(1-butyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(2,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 30376842 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 1-(1-butyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(2,4-dimethoxyphenyl)urea |
| SMILES | CCCCN1C(=O)CCc2cc(NC(=O)Nc3ccc(OC)cc3OC)ccc21 |
| InChI | InChI=1S/C22H27N3O4/c1-4-5-12-25-19-10-7-16(13-15(19)6-11-21(25)26)23-22(27)24-18-9-8-17(28-2)14-20(18)29-3/h7-10,13-14H,4-6,11-12H2,1-3H3,(H2,23,24,27) |
| InChIKey | KBLBLUSBCDSHNK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |