C20H22ClN3O2 — CID 30376690
1-(1-butyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(4-chlorophenyl)urea (PubChem CID 30376690) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 1-(1-butyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(4-chlorophenyl)urea.
| Compound Name | 1-(1-butyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 30376690 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 1-(1-butyl-2-oxo-3,4-dihydroquinolin-6-yl)-3-(4-chlorophenyl)urea |
| SMILES | CCCCN1C(=O)CCc2cc(NC(=O)Nc3ccc(Cl)cc3)ccc21 |
| InChI | InChI=1S/C20H22ClN3O2/c1-2-3-12-24-18-10-9-17(13-14(18)4-11-19(24)25)23-20(26)22-16-7-5-15(21)6-8-16/h5-10,13H,2-4,11-12H2,1H3,(H2,22,23,26) |
| InChIKey | INYZABAQXSMSSR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |