C18H19N3O3 — CID 75448652
1-cyclopentyl-N-(3-oxo-4H-1,4-benzoxazin-7-yl)pyrrole-2-carboxamide (PubChem CID 75448652) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 1-cyclopentyl-N-(3-oxo-4H-1,4-benzoxazin-7-yl)pyrrole-2-carboxamide.
| Compound Name | 1-cyclopentyl-N-(3-oxo-4H-1,4-benzoxazin-7-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 75448652 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 1-cyclopentyl-N-(3-oxo-4H-1,4-benzoxazin-7-yl)pyrrole-2-carboxamide |
| SMILES | O=C1COc2cc(NC(=O)c3cccn3C3CCCC3)ccc2N1 |
| InChI | InChI=1S/C18H19N3O3/c22-17-11-24-16-10-12(7-8-14(16)20-17)19-18(23)15-6-3-9-21(15)13-4-1-2-5-13/h3,6-10,13H,1-2,4-5,11H2,(H,19,23)(H,20,22) |
| InChIKey | WUWAIJLSPVNERH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |