C20H30N4O2 — CID 123819485
N-(cyclohexylmethyl)-2-(3-hydroxypyrrolidin-1-yl)-4-(methylamino)-5-(methylideneamino)benzamide (PubChem CID 123819485) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-(3-hydroxypyrrolidin-1-yl)-4-(methylamino)-5-(methylideneamino)benzamide.
| Compound Name | N-(cyclohexylmethyl)-2-(3-hydroxypyrrolidin-1-yl)-4-(methylamino)-5-(methylideneamino)benzamide |
|---|---|
| PubChem CID | 123819485 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | N-(cyclohexylmethyl)-2-(3-hydroxypyrrolidin-1-yl)-4-(methylamino)-5-(methylideneamino)benzamide |
| SMILES | C=Nc1cc(C(=O)NCC2CCCCC2)c(N2CCC(O)C2)cc1NC |
| InChI | InChI=1S/C20H30N4O2/c1-21-17-10-16(20(26)23-12-14-6-4-3-5-7-14)19(11-18(17)22-2)24-9-8-15(25)13-24/h10-11,14-15,22,25H,1,3-9,12-13H2,2H3,(H,23,26) |
| InChIKey | JHMKGUCUWFHDLG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|