C20H31FN4O — CID 67978098
5-amino-4-(ethylamino)-2-[(3R)-3-fluoropyrrolidin-1-yl]-N-(4-methylcyclohexyl)benzamide (PubChem CID 67978098) has the molecular formula C20H31FN4O and a molecular weight of 362.49 g/mol. Its IUPAC name is 5-amino-4-(ethylamino)-2-[(3R)-3-fluoropyrrolidin-1-yl]-N-(4-methylcyclohexyl)benzamide.
| Compound Name | 5-amino-4-(ethylamino)-2-[(3R)-3-fluoropyrrolidin-1-yl]-N-(4-methylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 67978098 |
| Molecular Formula | C20H31FN4O |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 5-amino-4-(ethylamino)-2-[(3R)-3-fluoropyrrolidin-1-yl]-N-(4-methylcyclohexyl)benzamide |
| SMILES | CCNc1cc(N2CC[C@@H](F)C2)c(C(=O)NC2CCC(C)CC2)cc1N |
| InChI | InChI=1S/C20H31FN4O/c1-3-23-18-11-19(25-9-8-14(21)12-25)16(10-17(18)22)20(26)24-15-6-4-13(2)5-7-15/h10-11,13-15,23H,3-9,12,22H2,1-2H3,(H,24,26)/t13?,14-,15?/m1/s1 |
| InChIKey | AFXGCJLYOSFMKL-SHARSMKWSA-N |
| XLogP | 3.56 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|