C21H29F3N4O2 — CID 67978893
5-amino-4-(methylamino)-2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-N-[4-(trifluoromethyl)cyclohexyl]benzamide (PubChem CID 67978893) has the molecular formula C21H29F3N4O2 and a molecular weight of 426.48 g/mol. Its IUPAC name is 5-amino-4-(methylamino)-2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-N-[4-(trifluoromethyl)cyclohexyl]benzamide.
| Compound Name | 5-amino-4-(methylamino)-2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-N-[4-(trifluoromethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 67978893 |
| Molecular Formula | C21H29F3N4O2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 5-amino-4-(methylamino)-2-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-N-[4-(trifluoromethyl)cyclohexyl]benzamide |
| SMILES | CNc1cc(N2CC3CCC(C2)O3)c(C(=O)NC2CCC(C(F)(F)F)CC2)cc1N |
| InChI | InChI=1S/C21H29F3N4O2/c1-26-18-9-19(28-10-14-6-7-15(11-28)30-14)16(8-17(18)25)20(29)27-13-4-2-12(3-5-13)21(22,23)24/h8-9,12-15,26H,2-7,10-11,25H2,1H3,(H,27,29) |
| InChIKey | HPDFAOXXTJUXKX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|