C20H29F3N4OS — CID 67978803
5-amino-4-(methylamino)-2-[methyl(thiolan-3-yl)amino]-N-[4-(trifluoromethyl)cyclohexyl]benzamide (PubChem CID 67978803) has the molecular formula C20H29F3N4OS and a molecular weight of 430.54 g/mol. Its IUPAC name is 5-amino-4-(methylamino)-2-[methyl(thiolan-3-yl)amino]-N-[4-(trifluoromethyl)cyclohexyl]benzamide.
| Compound Name | 5-amino-4-(methylamino)-2-[methyl(thiolan-3-yl)amino]-N-[4-(trifluoromethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 67978803 |
| Molecular Formula | C20H29F3N4OS |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 5-amino-4-(methylamino)-2-[methyl(thiolan-3-yl)amino]-N-[4-(trifluoromethyl)cyclohexyl]benzamide |
| SMILES | CNc1cc(N(C)C2CCSC2)c(C(=O)NC2CCC(C(F)(F)F)CC2)cc1N |
| InChI | InChI=1S/C20H29F3N4OS/c1-25-17-10-18(27(2)14-7-8-29-11-14)15(9-16(17)24)19(28)26-13-5-3-12(4-6-13)20(21,22)23/h9-10,12-14,25H,3-8,11,24H2,1-2H3,(H,26,28) |
| InChIKey | NRPRXUNCKSJPGW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|