C15H17ClF4N2O2 — CID 91153594
2-chloro-4-fluoro-5-[hydroxy(methyl)amino]-N-[4-(trifluoromethyl)cyclohexyl]benzamide (PubChem CID 91153594) has the molecular formula C15H17ClF4N2O2 and a molecular weight of 368.76 g/mol. Its IUPAC name is 2-chloro-4-fluoro-5-[hydroxy(methyl)amino]-N-[4-(trifluoromethyl)cyclohexyl]benzamide.
| Compound Name | 2-chloro-4-fluoro-5-[hydroxy(methyl)amino]-N-[4-(trifluoromethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 91153594 |
| Molecular Formula | C15H17ClF4N2O2 |
| Molecular Weight | 368.76 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-chloro-4-fluoro-5-[hydroxy(methyl)amino]-N-[4-(trifluoromethyl)cyclohexyl]benzamide |
| SMILES | CN(O)c1cc(C(=O)NC2CCC(C(F)(F)F)CC2)c(Cl)cc1F |
| InChI | InChI=1S/C15H17ClF4N2O2/c1-22(24)13-6-10(11(16)7-12(13)17)14(23)21-9-4-2-8(3-5-9)15(18,19)20/h6-9,24H,2-5H2,1H3,(H,21,23) |
| InChIKey | NVARFLXQPZJXGX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.76 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|