C18H24F3N5O4 — CID 67957525
2-[(2-amino-2-oxoethyl)-methylamino]-4-(methylamino)-5-nitro-N-[4-(trifluoromethyl)cyclohexyl]benzamide (PubChem CID 67957525) has the molecular formula C18H24F3N5O4 and a molecular weight of 431.42 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-methylamino]-4-(methylamino)-5-nitro-N-[4-(trifluoromethyl)cyclohexyl]benzamide.
| Compound Name | 2-[(2-amino-2-oxoethyl)-methylamino]-4-(methylamino)-5-nitro-N-[4-(trifluoromethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 67957525 |
| Molecular Formula | C18H24F3N5O4 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-methylamino]-4-(methylamino)-5-nitro-N-[4-(trifluoromethyl)cyclohexyl]benzamide |
| SMILES | CNc1cc(N(C)CC(N)=O)c(C(=O)NC2CCC(C(F)(F)F)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H24F3N5O4/c1-23-13-8-14(25(2)9-16(22)27)12(7-15(13)26(29)30)17(28)24-11-5-3-10(4-6-11)18(19,20)21/h7-8,10-11,23H,3-6,9H2,1-2H3,(H2,22,27)(H,24,28) |
| InChIKey | VXKJPCJOSYSXIH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|