C20H20F6N4O3 — CID 174708391
4-(methylamino)-5-nitro-N-[4-(trifluoromethyl)cyclohexyl]-2-[3-(trifluoromethyl)-1H-pyrrol-2-yl]benzamide (PubChem CID 174708391) has the molecular formula C20H20F6N4O3 and a molecular weight of 478.39 g/mol. Its IUPAC name is 4-(methylamino)-5-nitro-N-[4-(trifluoromethyl)cyclohexyl]-2-[3-(trifluoromethyl)-1H-pyrrol-2-yl]benzamide.
| Compound Name | 4-(methylamino)-5-nitro-N-[4-(trifluoromethyl)cyclohexyl]-2-[3-(trifluoromethyl)-1H-pyrrol-2-yl]benzamide |
|---|---|
| PubChem CID | 174708391 |
| Molecular Formula | C20H20F6N4O3 |
| Molecular Weight | 478.39 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 4-(methylamino)-5-nitro-N-[4-(trifluoromethyl)cyclohexyl]-2-[3-(trifluoromethyl)-1H-pyrrol-2-yl]benzamide |
| SMILES | CNc1cc(-c2[nH]ccc2C(F)(F)F)c(C(=O)NC2CCC(C(F)(F)F)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20F6N4O3/c1-27-15-8-12(17-14(6-7-28-17)20(24,25)26)13(9-16(15)30(32)33)18(31)29-11-4-2-10(3-5-11)19(21,22)23/h6-11,27-28H,2-5H2,1H3,(H,29,31) |
| InChIKey | SXKNAHMLWAXJPB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.39 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|