C23H29F3N4O3 — CID 147640785
2-(2-azabicyclo[2.2.1]heptan-2-yl)-4-(methylamino)-5-nitro-N-[(2R)-6-(trifluoromethyl)spiro[2.5]octan-2-yl]benzamide (PubChem CID 147640785) has the molecular formula C23H29F3N4O3 and a molecular weight of 466.50 g/mol. Its IUPAC name is 2-(2-azabicyclo[2.2.1]heptan-2-yl)-4-(methylamino)-5-nitro-N-[(2R)-6-(trifluoromethyl)spiro[2.5]octan-2-yl]benzamide.
| Compound Name | 2-(2-azabicyclo[2.2.1]heptan-2-yl)-4-(methylamino)-5-nitro-N-[(2R)-6-(trifluoromethyl)spiro[2.5]octan-2-yl]benzamide |
|---|---|
| PubChem CID | 147640785 |
| Molecular Formula | C23H29F3N4O3 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 2-(2-azabicyclo[2.2.1]heptan-2-yl)-4-(methylamino)-5-nitro-N-[(2R)-6-(trifluoromethyl)spiro[2.5]octan-2-yl]benzamide |
| SMILES | CNc1cc(N2CC3CCC2C3)c(C(=O)N[C@@H]2CC23CCC(C(F)(F)F)CC3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H29F3N4O3/c1-27-17-10-18(29-12-13-2-3-15(29)8-13)16(9-19(17)30(32)33)21(31)28-20-11-22(20)6-4-14(5-7-22)23(24,25)26/h9-10,13-15,20,27H,2-8,11-12H2,1H3,(H,28,31)/t13?,14?,15?,20-,22?/m1/s1 |
| InChIKey | GHONJGXUOPYIAJ-FUVRYZOOSA-N |
| XLogP | 4.87 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|